C22H30N2O5 — CID 23301038
(7-acetamido-4-butoxy-1-hexyl-2-oxoquinolin-3-yl) formate (PubChem CID 23301038) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is (7-acetamido-4-butoxy-1-hexyl-2-oxoquinolin-3-yl) formate.
| Compound Name | (7-acetamido-4-butoxy-1-hexyl-2-oxoquinolin-3-yl) formate |
|---|---|
| PubChem CID | 23301038 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (7-acetamido-4-butoxy-1-hexyl-2-oxoquinolin-3-yl) formate |
| SMILES | CCCCCCn1c(=O)c(OC=O)c(OCCCC)c2ccc(NC(C)=O)cc21 |
| InChI | InChI=1S/C22H30N2O5/c1-4-6-8-9-12-24-19-14-17(23-16(3)26)10-11-18(19)20(28-13-7-5-2)21(22(24)27)29-15-25/h10-11,14-15H,4-9,12-13H2,1-3H3,(H,23,26) |
| InChIKey | AHXGFCCKGOKUSF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|