C23H30N2O5 — CID 173290333
(7-acetamido-1-hexyl-2-oxo-4-pent-2-en-3-yloxyquinolin-3-yl) formate (PubChem CID 173290333) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is (7-acetamido-1-hexyl-2-oxo-4-pent-2-en-3-yloxyquinolin-3-yl) formate.
| Compound Name | (7-acetamido-1-hexyl-2-oxo-4-pent-2-en-3-yloxyquinolin-3-yl) formate |
|---|---|
| PubChem CID | 173290333 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (7-acetamido-1-hexyl-2-oxo-4-pent-2-en-3-yloxyquinolin-3-yl) formate |
| SMILES | CC=C(CC)Oc1c(OC=O)c(=O)n(CCCCCC)c2cc(NC(C)=O)ccc12 |
| InChI | InChI=1S/C23H30N2O5/c1-5-8-9-10-13-25-20-14-17(24-16(4)27)11-12-19(20)21(30-18(6-2)7-3)22(23(25)28)29-15-26/h6,11-12,14-15H,5,7-10,13H2,1-4H3,(H,24,27) |
| InChIKey | OKVZZSSZDORSTQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|