C35H50N2O3 — CID 70251246
7-(benzylamino)-3-(2-methylpentoxy)-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one (PubChem CID 70251246) has the molecular formula C35H50N2O3 and a molecular weight of 546.80 g/mol. Its IUPAC name is 7-(benzylamino)-3-(2-methylpentoxy)-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one.
| Compound Name | 7-(benzylamino)-3-(2-methylpentoxy)-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one |
|---|---|
| PubChem CID | 70251246 |
| Molecular Formula | C35H50N2O3 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | 7-(benzylamino)-3-(2-methylpentoxy)-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one |
| SMILES | CC=C(CC)Oc1c(OCC(C)CCC)c(=O)n(CCCCCCCC)c2cc(NCc3ccccc3)ccc12 |
| InChI | InChI=1S/C35H50N2O3/c1-6-10-11-12-13-17-23-37-32-24-29(36-25-28-19-15-14-16-20-28)21-22-31(32)33(40-30(8-3)9-4)34(35(37)38)39-26-27(5)18-7-2/h8,14-16,19-22,24,27,36H,6-7,9-13,17-18,23,25-26H2,1-5H3 |
| InChIKey | PTJXTQFJHKIJBW-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|