C32H48N2O3 — CID 70252670
7-amino-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one (PubChem CID 70252670) has the molecular formula C32H48N2O3 and a molecular weight of 508.75 g/mol. Its IUPAC name is 7-amino-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one.
| Compound Name | 7-amino-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one |
|---|---|
| PubChem CID | 70252670 |
| Molecular Formula | C32H48N2O3 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.37 |
| IUPAC Name | 7-amino-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one |
| SMILES | CC=C(CC)Oc1c(OC/C=C(\C)CCC=C(C)C)c(=O)n(CCCCCCCC)c2cc(N)ccc12 |
| InChI | InChI=1S/C32H48N2O3/c1-7-10-11-12-13-14-21-34-29-23-26(33)18-19-28(29)30(37-27(8-2)9-3)31(32(34)35)36-22-20-25(6)17-15-16-24(4)5/h8,16,18-20,23H,7,9-15,17,21-22,33H2,1-6H3/b25-20+,27-8? |
| InChIKey | UMKNOKQXKYTBII-UZGVRRPGSA-N |
| XLogP | 8.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|