C31H40N2O4 — CID 23300645
N-(4-hexoxy-1-hexyl-2-oxo-3-prop-2-enoxyquinolin-7-yl)benzamide (PubChem CID 23300645) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is N-(4-hexoxy-1-hexyl-2-oxo-3-prop-2-enoxyquinolin-7-yl)benzamide.
| Compound Name | N-(4-hexoxy-1-hexyl-2-oxo-3-prop-2-enoxyquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 23300645 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | N-(4-hexoxy-1-hexyl-2-oxo-3-prop-2-enoxyquinolin-7-yl)benzamide |
| SMILES | C=CCOc1c(OCCCCCC)c2ccc(NC(=O)c3ccccc3)cc2n(CCCCCC)c1=O |
| InChI | InChI=1S/C31H40N2O4/c1-4-7-9-14-20-33-27-23-25(32-30(34)24-16-12-11-13-17-24)18-19-26(27)28(37-22-15-10-8-5-2)29(31(33)35)36-21-6-3/h6,11-13,16-19,23H,3-5,7-10,14-15,20-22H2,1-2H3,(H,32,34) |
| InChIKey | DUNZBEYDDDCHFJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|