C21H27NO4 — CID 139717305
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-methoxy-1-methylquinolin-2-one (PubChem CID 139717305) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-methoxy-1-methylquinolin-2-one.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-methoxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 139717305 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-methoxy-1-methylquinolin-2-one |
| SMILES | COc1ccc2c(O)c(OC/C=C(\C)CCC=C(C)C)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C21H27NO4/c1-14(2)7-6-8-15(3)11-12-26-20-19(23)17-10-9-16(25-5)13-18(17)22(4)21(20)24/h7,9-11,13,23H,6,8,12H2,1-5H3/b15-11+ |
| InChIKey | KBMMSMHEUFTQPT-RVDMUPIBSA-N |
| XLogP | 4.32 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|