C32H39NO4 — CID 139717671
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-methyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one (PubChem CID 139717671) has the molecular formula C32H39NO4 and a molecular weight of 501.67 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-methyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-methyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717671 |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-methyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1c(OCC=C(C)C)c2ccc(OCc3ccccc3)cc2n(C)c1=O |
| InChI | InChI=1S/C32H39NO4/c1-23(2)11-10-12-25(5)18-20-36-31-30(35-19-17-24(3)4)28-16-15-27(21-29(28)33(6)32(31)34)37-22-26-13-8-7-9-14-26/h7-9,11,13-18,21H,10,12,19-20,22H2,1-6H3/b25-18+ |
| InChIKey | ILEVVHNCALVJGR-XIEYBQDHSA-N |
| XLogP | 7.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|