C16H21NO4 — CID 139717653
3-butoxy-4,7-dihydroxy-1-propan-2-ylquinolin-2-one (PubChem CID 139717653) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-butoxy-4,7-dihydroxy-1-propan-2-ylquinolin-2-one.
| Compound Name | 3-butoxy-4,7-dihydroxy-1-propan-2-ylquinolin-2-one |
|---|---|
| PubChem CID | 139717653 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-butoxy-4,7-dihydroxy-1-propan-2-ylquinolin-2-one |
| SMILES | CCCCOc1c(O)c2ccc(O)cc2n(C(C)C)c1=O |
| InChI | InChI=1S/C16H21NO4/c1-4-5-8-21-15-14(19)12-7-6-11(18)9-13(12)17(10(2)3)16(15)20/h6-7,9-10,18-19H,4-5,8H2,1-3H3 |
| InChIKey | XJXSADVJRDKVRF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|