C27H38N2O5 — CID 54043247
4-(3,7-dimethylocta-2,6-dienoxy)-1-ethyl-3-(2-methylpentoxy)-7-nitroquinolin-2-one (PubChem CID 54043247) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienoxy)-1-ethyl-3-(2-methylpentoxy)-7-nitroquinolin-2-one.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienoxy)-1-ethyl-3-(2-methylpentoxy)-7-nitroquinolin-2-one |
|---|---|
| PubChem CID | 54043247 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienoxy)-1-ethyl-3-(2-methylpentoxy)-7-nitroquinolin-2-one |
| SMILES | CCCC(C)COc1c(OCC=C(C)CCC=C(C)C)c2ccc([N+](=O)[O-])cc2n(CC)c1=O |
| InChI | InChI=1S/C27H38N2O5/c1-7-10-21(6)18-34-26-25(33-16-15-20(5)12-9-11-19(3)4)23-14-13-22(29(31)32)17-24(23)28(8-2)27(26)30/h11,13-15,17,21H,7-10,12,16,18H2,1-6H3 |
| InChIKey | LNUWSNCJAKXMED-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|