C24H22O7 — CID 19929300
[4-acetyloxy-7-[(E)-hex-3-enoxy]-2-oxochromen-3-yl] benzoate (PubChem CID 19929300) has the molecular formula C24H22O7 and a molecular weight of 422.43 g/mol. Its IUPAC name is [4-acetyloxy-7-[(E)-hex-3-enoxy]-2-oxochromen-3-yl] benzoate.
| Compound Name | [4-acetyloxy-7-[(E)-hex-3-enoxy]-2-oxochromen-3-yl] benzoate |
|---|---|
| PubChem CID | 19929300 |
| Molecular Formula | C24H22O7 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [4-acetyloxy-7-[(E)-hex-3-enoxy]-2-oxochromen-3-yl] benzoate |
| SMILES | CC/C=C/CCOc1ccc2c(OC(C)=O)c(OC(=O)c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H22O7/c1-3-4-5-9-14-28-18-12-13-19-20(15-18)30-24(27)22(21(19)29-16(2)25)31-23(26)17-10-7-6-8-11-17/h4-8,10-13,15H,3,9,14H2,1-2H3/b5-4+ |
| InChIKey | RGZWLKMNMRGMGT-SNAWJCMRSA-N |
| XLogP | 4.67 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|