C27H38O6 — CID 19928989
[7-decoxy-3-[(E)-hex-3-enoxy]-2-oxochromen-4-yl] acetate (PubChem CID 19928989) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is [7-decoxy-3-[(E)-hex-3-enoxy]-2-oxochromen-4-yl] acetate.
| Compound Name | [7-decoxy-3-[(E)-hex-3-enoxy]-2-oxochromen-4-yl] acetate |
|---|---|
| PubChem CID | 19928989 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | [7-decoxy-3-[(E)-hex-3-enoxy]-2-oxochromen-4-yl] acetate |
| SMILES | CC/C=C/CCOc1c(OC(C)=O)c2ccc(OCCCCCCCCCC)cc2oc1=O |
| InChI | InChI=1S/C27H38O6/c1-4-6-8-10-11-12-13-15-18-30-22-16-17-23-24(20-22)33-27(29)26(25(23)32-21(3)28)31-19-14-9-7-5-2/h7,9,16-17,20H,4-6,8,10-15,18-19H2,1-3H3/b9-7+ |
| InChIKey | PYVNWNPTGCDSIM-VQHVLOKHSA-N |
| XLogP | 6.97 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|