C29H36O6 — CID 19929041
(7-decoxy-2-oxo-3-propan-2-yloxychromen-4-yl) benzoate (PubChem CID 19929041) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is (7-decoxy-2-oxo-3-propan-2-yloxychromen-4-yl) benzoate.
| Compound Name | (7-decoxy-2-oxo-3-propan-2-yloxychromen-4-yl) benzoate |
|---|---|
| PubChem CID | 19929041 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (7-decoxy-2-oxo-3-propan-2-yloxychromen-4-yl) benzoate |
| SMILES | CCCCCCCCCCOc1ccc2c(OC(=O)c3ccccc3)c(OC(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C29H36O6/c1-4-5-6-7-8-9-10-14-19-32-23-17-18-24-25(20-23)34-29(31)27(33-21(2)3)26(24)35-28(30)22-15-12-11-13-16-22/h11-13,15-18,20-21H,4-10,14,19H2,1-3H3 |
| InChIKey | DQRHARMOWIMRGK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|