C23H32O10 — CID 54735380
4-hydroxy-3-octoxy-7-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (PubChem CID 54735380) has the molecular formula C23H32O10 and a molecular weight of 468.50 g/mol. Its IUPAC name is 4-hydroxy-3-octoxy-7-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one.
| Compound Name | 4-hydroxy-3-octoxy-7-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 54735380 |
| Molecular Formula | C23H32O10 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-hydroxy-3-octoxy-7-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | CCCCCCCCOc1c(O)c2ccc(OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2oc1=O |
| InChI | InChI=1S/C23H32O10/c1-2-3-4-5-6-7-10-30-21-17(25)14-9-8-13(11-15(14)32-22(21)29)31-23-20(28)19(27)18(26)16(12-24)33-23/h8-9,11,16,18-20,23-28H,2-7,10,12H2,1H3/t16-,18-,19+,20+,23?/m1/s1 |
| InChIKey | MHWSFVHVAWXPGU-TVMJVVNTSA-N |
| XLogP | 1.42 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|