C24H30O11 — CID 54066772
[4-(4-methylcyclohexyl)oxy-2-oxo-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl] acetate (PubChem CID 54066772) has the molecular formula C24H30O11 and a molecular weight of 494.49 g/mol. Its IUPAC name is [4-(4-methylcyclohexyl)oxy-2-oxo-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl] acetate.
| Compound Name | [4-(4-methylcyclohexyl)oxy-2-oxo-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl] acetate |
|---|---|
| PubChem CID | 54066772 |
| Molecular Formula | C24H30O11 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [4-(4-methylcyclohexyl)oxy-2-oxo-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl] acetate |
| SMILES | CC(=O)Oc1c(OC2CCC(C)CC2)c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2oc1=O |
| InChI | InChI=1S/C24H30O11/c1-11-3-5-13(6-4-11)32-21-15-8-7-14(9-16(15)34-23(30)22(21)31-12(2)26)33-24-20(29)19(28)18(27)17(10-25)35-24/h7-9,11,13,17-20,24-25,27-29H,3-6,10H2,1-2H3/t11?,13?,17-,18-,19+,20+,24+/m1/s1 |
| InChIKey | MDODUTDJANOCEV-GEQGNIBPSA-N |
| XLogP | 0.85 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|