C23H22O11 — CID 54059710
[7-methoxy-2-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl] benzoate (PubChem CID 54059710) has the molecular formula C23H22O11 and a molecular weight of 474.42 g/mol. Its IUPAC name is [7-methoxy-2-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl] benzoate.
| Compound Name | [7-methoxy-2-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl] benzoate |
|---|---|
| PubChem CID | 54059710 |
| Molecular Formula | C23H22O11 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [7-methoxy-2-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl] benzoate |
| SMILES | COc1ccc2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC(=O)c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C23H22O11/c1-30-12-7-8-13-14(9-12)31-22(29)20(33-21(28)11-5-3-2-4-6-11)19(13)34-23-18(27)17(26)16(25)15(10-24)32-23/h2-9,15-18,23-27H,10H2,1H3/t15-,16-,17+,18-,23+/m1/s1 |
| InChIKey | LYUOTLIIIQIBTD-HVRFAWQISA-N |
| XLogP | 0.20 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|