C22H22O10 — CID 54223884
3-hydroxy-7-phenylmethoxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (PubChem CID 54223884) has the molecular formula C22H22O10 and a molecular weight of 446.41 g/mol. Its IUPAC name is 3-hydroxy-7-phenylmethoxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one.
| Compound Name | 3-hydroxy-7-phenylmethoxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 54223884 |
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-hydroxy-7-phenylmethoxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | O=c1oc2cc(OCc3ccccc3)ccc2c(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C22H22O10/c23-9-15-16(24)17(25)18(26)22(31-15)32-20-13-7-6-12(8-14(13)30-21(28)19(20)27)29-10-11-4-2-1-3-5-11/h1-8,15-18,22-27H,9-10H2/t15-,16+,17+,18-,22+/m1/s1 |
| InChIKey | QEMXBNUAMQDRES-RSVWRCHESA-N |
| XLogP | 0.26 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|