C23H24O10 — CID 54513316
7-methoxy-4-phenylmethoxy-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (PubChem CID 54513316) has the molecular formula C23H24O10 and a molecular weight of 460.44 g/mol. Its IUPAC name is 7-methoxy-4-phenylmethoxy-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one.
| Compound Name | 7-methoxy-4-phenylmethoxy-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 54513316 |
| Molecular Formula | C23H24O10 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 7-methoxy-4-phenylmethoxy-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | COc1ccc2c(OCc3ccccc3)c(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c(=O)oc2c1 |
| InChI | InChI=1S/C23H24O10/c1-29-13-7-8-14-15(9-13)31-22(28)21(20(14)30-11-12-5-3-2-4-6-12)33-23-19(27)18(26)17(25)16(10-24)32-23/h2-9,16-19,23-27H,10-11H2,1H3/t16-,17-,18+,19+,23-/m1/s1 |
| InChIKey | YKRBMXZIRKHTMG-WWGUSRDYSA-N |
| XLogP | 0.56 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|