C22H22O10 — CID 171936114
1-acetyl-8-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one (PubChem CID 171936114) has the molecular formula C22H22O10 and a molecular weight of 446.41 g/mol. Its IUPAC name is 1-acetyl-8-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one.
| Compound Name | 1-acetyl-8-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 171936114 |
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 1-acetyl-8-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one |
| SMILES | COc1ccc2c(c1)c(=O)oc1cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(C(C)=O)c12 |
| InChI | InChI=1S/C22H22O10/c1-9(24)13-6-11(30-22-20(27)19(26)18(25)16(8-23)32-22)7-15-17(13)12-4-3-10(29-2)5-14(12)21(28)31-15/h3-7,16,18-20,22-23,25-27H,8H2,1-2H3/t16-,18-,19+,20-,22-/m1/s1 |
| InChIKey | YKLPDAAAYLTXRU-QKYBYQKWSA-N |
| XLogP | 0.34 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|