C22H24O9 — CID 171936110
8-methoxy-1,4-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one (PubChem CID 171936110) has the molecular formula C22H24O9 and a molecular weight of 432.43 g/mol. Its IUPAC name is 8-methoxy-1,4-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one.
| Compound Name | 8-methoxy-1,4-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 171936110 |
| Molecular Formula | C22H24O9 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 8-methoxy-1,4-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one |
| SMILES | COc1ccc2c(c1)c(=O)oc1c(C)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(C)c12 |
| InChI | InChI=1S/C22H24O9/c1-9-6-14(29-22-19(26)18(25)17(24)15(8-23)30-22)10(2)20-16(9)12-5-4-11(28-3)7-13(12)21(27)31-20/h4-7,15,17-19,22-26H,8H2,1-3H3/t15-,17-,18+,19-,22-/m1/s1 |
| InChIKey | SABZBFHVWOSNKX-DRASZATQSA-N |
| XLogP | 0.75 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|