C23H26O10 — CID 171936104
7-(2-hydroxyethyl)-4-methoxy-1-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one (PubChem CID 171936104) has the molecular formula C23H26O10 and a molecular weight of 462.45 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-4-methoxy-1-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one.
| Compound Name | 7-(2-hydroxyethyl)-4-methoxy-1-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 171936104 |
| Molecular Formula | C23H26O10 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 7-(2-hydroxyethyl)-4-methoxy-1-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one |
| SMILES | COc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(C)c2c1oc(=O)c1c(CCO)cccc12 |
| InChI | InChI=1S/C23H26O10/c1-10-8-13(31-23-19(28)18(27)17(26)14(9-25)32-23)20(30-2)21-15(10)12-5-3-4-11(6-7-24)16(12)22(29)33-21/h3-5,8,14,17-19,23-28H,6-7,9H2,1-2H3/t14-,17-,18+,19-,23-/m1/s1 |
| InChIKey | ZKXQQANWNGHVTM-ARSJFUCGSA-N |
| XLogP | -0.02 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|