C21H19ClO10 — CID 171936182
6-chloro-9-methyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-[1,3]benzodioxolo[7,6-c]chromen-4-one (PubChem CID 171936182) has the molecular formula C21H19ClO10 and a molecular weight of 466.83 g/mol. Its IUPAC name is 6-chloro-9-methyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-[1,3]benzodioxolo[7,6-c]chromen-4-one.
| Compound Name | 6-chloro-9-methyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-[1,3]benzodioxolo[7,6-c]chromen-4-one |
|---|---|
| PubChem CID | 171936182 |
| Molecular Formula | C21H19ClO10 |
| Molecular Weight | 466.83 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 6-chloro-9-methyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-[1,3]benzodioxolo[7,6-c]chromen-4-one |
| SMILES | Cc1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(Cl)c2oc(=O)c3c4c(ccc3c12)OCO4 |
| InChI | InChI=1S/C21H19ClO10/c1-7-4-10(30-21-17(26)16(25)15(24)11(5-23)31-21)14(22)19-12(7)8-2-3-9-18(29-6-28-9)13(8)20(27)32-19/h2-4,11,15-17,21,23-26H,5-6H2,1H3/t11-,15-,16+,17-,21-/m1/s1 |
| InChIKey | FYJIBNDTEFDRFV-XLDQOYKASA-N |
| XLogP | 0.82 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.83 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|