C15H9ClO5 — CID 171936179
8-chloro-9-hydroxy-11-methyl-[1,3]benzodioxolo[6,7-c]chromen-6-one (PubChem CID 171936179) has the molecular formula C15H9ClO5 and a molecular weight of 304.69 g/mol. Its IUPAC name is 8-chloro-9-hydroxy-11-methyl-[1,3]benzodioxolo[6,7-c]chromen-6-one.
| Compound Name | 8-chloro-9-hydroxy-11-methyl-[1,3]benzodioxolo[6,7-c]chromen-6-one |
|---|---|
| PubChem CID | 171936179 |
| Molecular Formula | C15H9ClO5 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 8-chloro-9-hydroxy-11-methyl-[1,3]benzodioxolo[6,7-c]chromen-6-one |
| SMILES | Cc1cc(O)c(Cl)c2oc(=O)c3ccc4c(c3c12)OCO4 |
| InChI | InChI=1S/C15H9ClO5/c1-6-4-8(17)12(16)14-10(6)11-7(15(18)21-14)2-3-9-13(11)20-5-19-9/h2-4,17H,5H2,1H3 |
| InChIKey | HHTVBKKIVUIQIA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|