C20H13ClO6 — CID 97487849
(10R)-10-(7-chloro-1,3-benzodioxol-5-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione (PubChem CID 97487849) has the molecular formula C20H13ClO6 and a molecular weight of 384.77 g/mol. Its IUPAC name is (10R)-10-(7-chloro-1,3-benzodioxol-5-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione.
| Compound Name | (10R)-10-(7-chloro-1,3-benzodioxol-5-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
|---|---|
| PubChem CID | 97487849 |
| Molecular Formula | C20H13ClO6 |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (10R)-10-(7-chloro-1,3-benzodioxol-5-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)OC(=O)C[C@@H]3c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C20H13ClO6/c1-9-4-16(22)27-19-11(9)2-3-14-18(19)12(7-17(23)26-14)10-5-13(21)20-15(6-10)24-8-25-20/h2-6,12H,7-8H2,1H3/t12-/m1/s1 |
| InChIKey | QDURLQXVQRVKFX-GFCCVEGCSA-N |
| XLogP | 3.92 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|