C16H9ClN2O4S — CID 97496830
(9S)-9-(7-chloro-1,3-benzodioxol-5-yl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one (PubChem CID 97496830) has the molecular formula C16H9ClN2O4S and a molecular weight of 360.78 g/mol. Its IUPAC name is (9S)-9-(7-chloro-1,3-benzodioxol-5-yl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one.
| Compound Name | (9S)-9-(7-chloro-1,3-benzodioxol-5-yl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one |
|---|---|
| PubChem CID | 97496830 |
| Molecular Formula | C16H9ClN2O4S |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | (9S)-9-(7-chloro-1,3-benzodioxol-5-yl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one |
| SMILES | O=C1C[C@@H](c2cc(Cl)c3c(c2)OCO3)c2c(ccc3nsnc23)O1 |
| InChI | InChI=1S/C16H9ClN2O4S/c17-9-3-7(4-12-16(9)22-6-21-12)8-5-13(20)23-11-2-1-10-15(14(8)11)19-24-18-10/h1-4,8H,5-6H2/t8-/m0/s1 |
| InChIKey | NHXWTFXZLQMILQ-QMMMGPOBSA-N |
| XLogP | 3.51 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|