C15H8ClFN2O2S — CID 97496522
(9S)-9-(3-chloro-4-fluorophenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one (PubChem CID 97496522) has the molecular formula C15H8ClFN2O2S and a molecular weight of 334.76 g/mol. Its IUPAC name is (9S)-9-(3-chloro-4-fluorophenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one.
| Compound Name | (9S)-9-(3-chloro-4-fluorophenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one |
|---|---|
| PubChem CID | 97496522 |
| Molecular Formula | C15H8ClFN2O2S |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | (9S)-9-(3-chloro-4-fluorophenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one |
| SMILES | O=C1C[C@@H](c2ccc(F)c(Cl)c2)c2c(ccc3nsnc23)O1 |
| InChI | InChI=1S/C15H8ClFN2O2S/c16-9-5-7(1-2-10(9)17)8-6-13(20)21-12-4-3-11-15(14(8)12)19-22-18-11/h1-5,8H,6H2/t8-/m0/s1 |
| InChIKey | JVQKCFYJJYGRNL-QMMMGPOBSA-N |
| XLogP | 3.92 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|