C22H12ClF3O4 — CID 126418948
(4S)-6-(4-chlorobenzoyl)-5-hydroxy-4-(3,4,5-trifluorophenyl)-3,4-dihydrochromen-2-one (PubChem CID 126418948) has the molecular formula C22H12ClF3O4 and a molecular weight of 432.78 g/mol. Its IUPAC name is (4S)-6-(4-chlorobenzoyl)-5-hydroxy-4-(3,4,5-trifluorophenyl)-3,4-dihydrochromen-2-one.
| Compound Name | (4S)-6-(4-chlorobenzoyl)-5-hydroxy-4-(3,4,5-trifluorophenyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 126418948 |
| Molecular Formula | C22H12ClF3O4 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | (4S)-6-(4-chlorobenzoyl)-5-hydroxy-4-(3,4,5-trifluorophenyl)-3,4-dihydrochromen-2-one |
| SMILES | O=C1C[C@@H](c2cc(F)c(F)c(F)c2)c2c(ccc(C(=O)c3ccc(Cl)cc3)c2O)O1 |
| InChI | InChI=1S/C22H12ClF3O4/c23-12-3-1-10(2-4-12)21(28)13-5-6-17-19(22(13)29)14(9-18(27)30-17)11-7-15(24)20(26)16(25)8-11/h1-8,14,29H,9H2/t14-/m0/s1 |
| InChIKey | MUACLNYDJVTGNH-AWEZNQCLSA-N |
| XLogP | 5.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|