C20H15NO4 — CID 99991768
(4R)-6-acetyl-5-hydroxy-4-quinolin-6-yl-3,4-dihydrochromen-2-one (PubChem CID 99991768) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is (4R)-6-acetyl-5-hydroxy-4-quinolin-6-yl-3,4-dihydrochromen-2-one.
| Compound Name | (4R)-6-acetyl-5-hydroxy-4-quinolin-6-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 99991768 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (4R)-6-acetyl-5-hydroxy-4-quinolin-6-yl-3,4-dihydrochromen-2-one |
| SMILES | CC(=O)c1ccc2c(c1O)[C@@H](c1ccc3ncccc3c1)CC(=O)O2 |
| InChI | InChI=1S/C20H15NO4/c1-11(22)14-5-7-17-19(20(14)24)15(10-18(23)25-17)12-4-6-16-13(9-12)3-2-8-21-16/h2-9,15,24H,10H2,1H3/t15-/m1/s1 |
| InChIKey | SRYXOFDJHVWJBQ-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|