C23H17ClO4S — CID 125122081
(4R)-6-(4-chlorobenzoyl)-5-hydroxy-4-(4-methylsulfanylphenyl)-3,4-dihydrochromen-2-one (PubChem CID 125122081) has the molecular formula C23H17ClO4S and a molecular weight of 424.91 g/mol. Its IUPAC name is (4R)-6-(4-chlorobenzoyl)-5-hydroxy-4-(4-methylsulfanylphenyl)-3,4-dihydrochromen-2-one.
| Compound Name | (4R)-6-(4-chlorobenzoyl)-5-hydroxy-4-(4-methylsulfanylphenyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 125122081 |
| Molecular Formula | C23H17ClO4S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (4R)-6-(4-chlorobenzoyl)-5-hydroxy-4-(4-methylsulfanylphenyl)-3,4-dihydrochromen-2-one |
| SMILES | CSc1ccc([C@H]2CC(=O)Oc3ccc(C(=O)c4ccc(Cl)cc4)c(O)c32)cc1 |
| InChI | InChI=1S/C23H17ClO4S/c1-29-16-8-4-13(5-9-16)18-12-20(25)28-19-11-10-17(23(27)21(18)19)22(26)14-2-6-15(24)7-3-14/h2-11,18,27H,12H2,1H3/t18-/m1/s1 |
| InChIKey | CUFKRKLTSXGFNB-GOSISDBHSA-N |
| XLogP | 5.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|