C24H19ClO6 — CID 125122556
(4S)-6-(4-chlorobenzoyl)-4-(3,4-dimethoxyphenyl)-5-hydroxy-3,4-dihydrochromen-2-one (PubChem CID 125122556) has the molecular formula C24H19ClO6 and a molecular weight of 438.86 g/mol. Its IUPAC name is (4S)-6-(4-chlorobenzoyl)-4-(3,4-dimethoxyphenyl)-5-hydroxy-3,4-dihydrochromen-2-one.
| Compound Name | (4S)-6-(4-chlorobenzoyl)-4-(3,4-dimethoxyphenyl)-5-hydroxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 125122556 |
| Molecular Formula | C24H19ClO6 |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (4S)-6-(4-chlorobenzoyl)-4-(3,4-dimethoxyphenyl)-5-hydroxy-3,4-dihydrochromen-2-one |
| SMILES | COc1ccc([C@@H]2CC(=O)Oc3ccc(C(=O)c4ccc(Cl)cc4)c(O)c32)cc1OC |
| InChI | InChI=1S/C24H19ClO6/c1-29-18-9-5-14(11-20(18)30-2)17-12-21(26)31-19-10-8-16(24(28)22(17)19)23(27)13-3-6-15(25)7-4-13/h3-11,17,28H,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | LNHODENFHOZPOJ-KRWDZBQOSA-N |
| XLogP | 4.73 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|