C26H18ClNO5 — CID 125122090
3-[(4S)-6-(4-chlorobenzoyl)-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]-1-methylquinolin-2-one (PubChem CID 125122090) has the molecular formula C26H18ClNO5 and a molecular weight of 459.89 g/mol. Its IUPAC name is 3-[(4S)-6-(4-chlorobenzoyl)-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]-1-methylquinolin-2-one.
| Compound Name | 3-[(4S)-6-(4-chlorobenzoyl)-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 125122090 |
| Molecular Formula | C26H18ClNO5 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 3-[(4S)-6-(4-chlorobenzoyl)-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c([C@H]2CC(=O)Oc3ccc(C(=O)c4ccc(Cl)cc4)c(O)c32)cc2ccccc21 |
| InChI | InChI=1S/C26H18ClNO5/c1-28-20-5-3-2-4-15(20)12-19(26(28)32)18-13-22(29)33-21-11-10-17(25(31)23(18)21)24(30)14-6-8-16(27)9-7-14/h2-12,18,31H,13H2,1H3/t18-/m1/s1 |
| InChIKey | DBBPEIJOTGLBGP-GOSISDBHSA-N |
| XLogP | 4.57 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|