C25H20O7 — CID 124879200
methyl 2-[2-[(4S)-6-benzoyl-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]phenoxy]acetate (PubChem CID 124879200) has the molecular formula C25H20O7 and a molecular weight of 432.43 g/mol. Its IUPAC name is methyl 2-[2-[(4S)-6-benzoyl-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(4S)-6-benzoyl-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 124879200 |
| Molecular Formula | C25H20O7 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | methyl 2-[2-[(4S)-6-benzoyl-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1[C@@H]1CC(=O)Oc2ccc(C(=O)c3ccccc3)c(O)c21 |
| InChI | InChI=1S/C25H20O7/c1-30-22(27)14-31-19-10-6-5-9-16(19)18-13-21(26)32-20-12-11-17(25(29)23(18)20)24(28)15-7-3-2-4-8-15/h2-12,18,29H,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | QOWICSNJSUKTKG-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|