C29H24O10 — CID 110206397
2-[2-[(2Z)-3,7-dioxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetic acid (PubChem CID 110206397) has the molecular formula C29H24O10 and a molecular weight of 532.50 g/mol. Its IUPAC name is 2-[2-[(2Z)-3,7-dioxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(2Z)-3,7-dioxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 110206397 |
| Molecular Formula | C29H24O10 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 2-[2-[(2Z)-3,7-dioxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetic acid |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1\Oc2c(ccc3c2C(c2ccccc2OCC(=O)O)CC(=O)O3)C1=O |
| InChI | InChI=1S/C29H24O10/c1-34-21-13-23(36-3)22(35-2)10-15(21)11-24-28(33)17-8-9-20-27(29(17)39-24)18(12-26(32)38-20)16-6-4-5-7-19(16)37-14-25(30)31/h4-11,13,18H,12,14H2,1-3H3,(H,30,31)/b24-11- |
| InChIKey | CQAJCFRGDPOLIC-MYKKPKGFSA-N |
| XLogP | 4.23 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|