C32H30O9 — CID 125428555
(2Z,9S)-9-[3-methoxy-2-(2-methylprop-2-enoxy)phenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125428555) has the molecular formula C32H30O9 and a molecular weight of 558.58 g/mol. Its IUPAC name is (2Z,9S)-9-[3-methoxy-2-(2-methylprop-2-enoxy)phenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-9-[3-methoxy-2-(2-methylprop-2-enoxy)phenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125428555 |
| Molecular Formula | C32H30O9 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (2Z,9S)-9-[3-methoxy-2-(2-methylprop-2-enoxy)phenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | C=C(C)COc1c(OC)cccc1[C@@H]1CC(=O)Oc2ccc3c(c21)O/C(=C\c1cc(OC)c(OC)cc1OC)C3=O |
| InChI | InChI=1S/C32H30O9/c1-17(2)16-39-31-19(8-7-9-23(31)35-3)21-14-28(33)40-22-11-10-20-30(34)27(41-32(20)29(21)22)13-18-12-25(37-5)26(38-6)15-24(18)36-4/h7-13,15,21H,1,14,16H2,2-6H3/b27-13-/t21-/m0/s1 |
| InChIKey | OZNLHFCAUFMBSU-DGBIYHDASA-N |
| XLogP | 5.73 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|