C36H32O9 — CID 163072101
2-[(2,3-dimethoxyphenyl)methylidene]-9-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163072101) has the molecular formula C36H32O9 and a molecular weight of 608.64 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methylidene]-9-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methylidene]-9-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163072101 |
| Molecular Formula | C36H32O9 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methylidene]-9-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(CCOc2c(OC)cccc2C2CC(=O)Oc3ccc4c(c32)OC(=Cc2cccc(OC)c2OC)C4=O)cc1 |
| InChI | InChI=1S/C36H32O9/c1-39-23-13-11-21(12-14-23)17-18-43-35-24(8-6-10-29(35)41-3)26-20-31(37)44-27-16-15-25-33(38)30(45-36(25)32(26)27)19-22-7-5-9-28(40-2)34(22)42-4/h5-16,19,26H,17-18,20H2,1-4H3 |
| InChIKey | BYSCBPAAVWUCCU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|