C35H28O8 — CID 125122742
(2Z,9S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125122742) has the molecular formula C35H28O8 and a molecular weight of 576.60 g/mol. Its IUPAC name is (2Z,9S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125122742 |
| Molecular Formula | C35H28O8 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | (2Z,9S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-9-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(CCOc2ccccc2[C@@H]2CC(=O)Oc3ccc4c(c32)O/C(=C\c2ccc3c(c2)OCCO3)C4=O)cc1 |
| InChI | InChI=1S/C35H28O8/c1-38-23-9-6-21(7-10-23)14-15-39-27-5-3-2-4-24(27)26-20-32(36)42-29-13-11-25-34(37)31(43-35(25)33(26)29)19-22-8-12-28-30(18-22)41-17-16-40-28/h2-13,18-19,26H,14-17,20H2,1H3/b31-19-/t26-/m0/s1 |
| InChIKey | OKUKMAWKKAOEBX-ZMIIAFDNSA-N |
| XLogP | 6.15 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|