C27H20O8 — CID 91638116
2-[2-[(2Z)-2-[(4-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetic acid (PubChem CID 91638116) has the molecular formula C27H20O8 and a molecular weight of 472.45 g/mol. Its IUPAC name is 2-[2-[(2Z)-2-[(4-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(2Z)-2-[(4-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 91638116 |
| Molecular Formula | C27H20O8 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[2-[(2Z)-2-[(4-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetic acid |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3C(c3ccccc3OCC(=O)O)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C27H20O8/c1-32-16-8-6-15(7-9-16)12-22-26(31)18-10-11-21-25(27(18)35-22)19(13-24(30)34-21)17-4-2-3-5-20(17)33-14-23(28)29/h2-12,19H,13-14H2,1H3,(H,28,29)/b22-12- |
| InChIKey | OMYOEXNJJCVBQO-UUYOSTAYSA-N |
| XLogP | 4.22 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|