C25H18O5 — CID 162879710
2-benzylidene-9-(2-methoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 162879710) has the molecular formula C25H18O5 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-benzylidene-9-(2-methoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 2-benzylidene-9-(2-methoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 162879710 |
| Molecular Formula | C25H18O5 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-benzylidene-9-(2-methoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccccc1C1CC(=O)Oc2ccc3c(c21)OC(=Cc1ccccc1)C3=O |
| InChI | InChI=1S/C25H18O5/c1-28-19-10-6-5-9-16(19)18-14-22(26)29-20-12-11-17-24(27)21(30-25(17)23(18)20)13-15-7-3-2-4-8-15/h2-13,18H,14H2,1H3 |
| InChIKey | CEMUAKXFULLTDL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|