C26H21NO5 — CID 162941474
9-(2-propan-2-yloxyphenyl)-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 162941474) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 9-(2-propan-2-yloxyphenyl)-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-(2-propan-2-yloxyphenyl)-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 162941474 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 9-(2-propan-2-yloxyphenyl)-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | CC(C)Oc1ccccc1C1CC(=O)Oc2ccc3c(c21)OC(=Cc1cccnc1)C3=O |
| InChI | InChI=1S/C26H21NO5/c1-15(2)30-20-8-4-3-7-17(20)19-13-23(28)31-21-10-9-18-25(29)22(32-26(18)24(19)21)12-16-6-5-11-27-14-16/h3-12,14-15,19H,13H2,1-2H3 |
| InChIKey | QXEUUWXYDRATTF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|