C33H25NO6 — CID 162981361
9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 162981361) has the molecular formula C33H25NO6 and a molecular weight of 531.56 g/mol. Its IUPAC name is 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 162981361 |
| Molecular Formula | C33H25NO6 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1CC(c2ccccc2OCCc2ccc3c(c2)CCO3)c2c(ccc3c2OC(=Cc2cccnc2)C3=O)O1 |
| InChI | InChI=1S/C33H25NO6/c35-30-18-25(23-5-1-2-6-27(23)38-14-11-20-7-9-26-22(16-20)12-15-37-26)31-28(39-30)10-8-24-32(36)29(40-33(24)31)17-21-4-3-13-34-19-21/h1-10,13,16-17,19,25H,11-12,14-15,18H2 |
| InChIKey | WVRVLVPECKTFRC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|