C25H18N2O6 — CID 102564674
2-[3-[(2Z)-3,7-dioxo-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetamide (PubChem CID 102564674) has the molecular formula C25H18N2O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is 2-[3-[(2Z)-3,7-dioxo-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetamide.
| Compound Name | 2-[3-[(2Z)-3,7-dioxo-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 102564674 |
| Molecular Formula | C25H18N2O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[3-[(2Z)-3,7-dioxo-2-(pyridin-3-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetamide |
| SMILES | NC(=O)COc1cccc(C2CC(=O)Oc3ccc4c(c32)O/C(=C\c2cccnc2)C4=O)c1 |
| InChI | InChI=1S/C25H18N2O6/c26-21(28)13-31-16-5-1-4-15(10-16)18-11-22(29)32-19-7-6-17-24(30)20(33-25(17)23(18)19)9-14-3-2-8-27-12-14/h1-10,12,18H,11,13H2,(H2,26,28)/b20-9- |
| InChIKey | MYIBGVJECPISJV-UKWGHVSLSA-N |
| XLogP | 3.00 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|