C26H18O7 — CID 125121922
methyl 4-[(Z)-[(9S)-9-(3-hydroxyphenyl)-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-2-ylidene]methyl]benzoate (PubChem CID 125121922) has the molecular formula C26H18O7 and a molecular weight of 442.42 g/mol. Its IUPAC name is methyl 4-[(Z)-[(9S)-9-(3-hydroxyphenyl)-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-2-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[(9S)-9-(3-hydroxyphenyl)-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-2-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 125121922 |
| Molecular Formula | C26H18O7 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | methyl 4-[(Z)-[(9S)-9-(3-hydroxyphenyl)-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-2-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\Oc3c(ccc4c3[C@H](c3cccc(O)c3)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C26H18O7/c1-31-26(30)15-7-5-14(6-8-15)11-21-24(29)18-9-10-20-23(25(18)33-21)19(13-22(28)32-20)16-3-2-4-17(27)12-16/h2-12,19,27H,13H2,1H3/b21-11-/t19-/m0/s1 |
| InChIKey | AGVFQGJATWQOII-POJBONIESA-N |
| XLogP | 4.24 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|