C34H24O11 — CID 163091497
dimethyl 5-[5-[2-[(4-methoxycarbonylphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzene-1,3-dicarboxylate (PubChem CID 163091497) has the molecular formula C34H24O11 and a molecular weight of 608.56 g/mol. Its IUPAC name is dimethyl 5-[5-[2-[(4-methoxycarbonylphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[5-[2-[(4-methoxycarbonylphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 163091497 |
| Molecular Formula | C34H24O11 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | dimethyl 5-[5-[2-[(4-methoxycarbonylphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1ccc(C=C2Oc3c(ccc4c3C(c3ccc(-c5cc(C(=O)OC)cc(C(=O)OC)c5)o3)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C34H24O11/c1-40-32(37)18-6-4-17(5-7-18)12-27-30(36)22-8-9-26-29(31(22)45-27)23(16-28(35)44-26)25-11-10-24(43-25)19-13-20(33(38)41-2)15-21(14-19)34(39)42-3/h4-15,23H,16H2,1-3H3 |
| InChIKey | KXXYVPGXBXEKTB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 144.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|