C30H20O8 — CID 163091821
4-[5-[2-[(2-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzoic acid (PubChem CID 163091821) has the molecular formula C30H20O8 and a molecular weight of 508.48 g/mol. Its IUPAC name is 4-[5-[2-[(2-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[2-[(2-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 163091821 |
| Molecular Formula | C30H20O8 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 4-[5-[2-[(2-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzoic acid |
| SMILES | COc1ccccc1C=C1Oc2c(ccc3c2C(c2ccc(-c4ccc(C(=O)O)cc4)o2)CC(=O)O3)C1=O |
| InChI | InChI=1S/C30H20O8/c1-35-21-5-3-2-4-18(21)14-25-28(32)19-10-11-24-27(29(19)38-25)20(15-26(31)37-24)23-13-12-22(36-23)16-6-8-17(9-7-16)30(33)34/h2-14,20H,15H2,1H3,(H,33,34) |
| InChIKey | UDXAFPBXIIBTSO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|