C31H22O9 — CID 163009950
4-[5-[2-[(2,4-dimethoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzoic acid (PubChem CID 163009950) has the molecular formula C31H22O9 and a molecular weight of 538.51 g/mol. Its IUPAC name is 4-[5-[2-[(2,4-dimethoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[2-[(2,4-dimethoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 163009950 |
| Molecular Formula | C31H22O9 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 4-[5-[2-[(2,4-dimethoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]furan-2-yl]benzoic acid |
| SMILES | COc1ccc(C=C2Oc3c(ccc4c3C(c3ccc(-c5ccc(C(=O)O)cc5)o3)CC(=O)O4)C2=O)c(OC)c1 |
| InChI | InChI=1S/C31H22O9/c1-36-19-8-7-18(25(14-19)37-2)13-26-29(33)20-9-10-24-28(30(20)40-26)21(15-27(32)39-24)23-12-11-22(38-23)16-3-5-17(6-4-16)31(34)35/h3-14,21H,15H2,1-2H3,(H,34,35) |
| InChIKey | MDUQNXLUSFUXAB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|