C29H23NO7 — CID 125122614
(2Z,9R)-9-(3-hydroxy-4-methoxyphenyl)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125122614) has the molecular formula C29H23NO7 and a molecular weight of 497.50 g/mol. Its IUPAC name is (2Z,9R)-9-(3-hydroxy-4-methoxyphenyl)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-(3-hydroxy-4-methoxyphenyl)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125122614 |
| Molecular Formula | C29H23NO7 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | (2Z,9R)-9-(3-hydroxy-4-methoxyphenyl)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc2c(c1)c(/C=C1\Oc3c(ccc4c3[C@@H](c3ccc(OC)c(O)c3)CC(=O)O4)C1=O)cn2C |
| InChI | InChI=1S/C29H23NO7/c1-30-14-16(19-12-17(34-2)5-7-21(19)30)11-25-28(33)18-6-9-24-27(29(18)37-25)20(13-26(32)36-24)15-4-8-23(35-3)22(31)10-15/h4-12,14,20,31H,13H2,1-3H3/b25-11-/t20-/m1/s1 |
| InChIKey | MHYDNCVVMHIDNQ-VGHSNCDSSA-N |
| XLogP | 4.96 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|