C23H16O7 — CID 162880920
2-(furan-2-ylmethylidene)-9-(3-hydroxy-4-methoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 162880920) has the molecular formula C23H16O7 and a molecular weight of 404.37 g/mol. Its IUPAC name is 2-(furan-2-ylmethylidene)-9-(3-hydroxy-4-methoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 2-(furan-2-ylmethylidene)-9-(3-hydroxy-4-methoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 162880920 |
| Molecular Formula | C23H16O7 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-(furan-2-ylmethylidene)-9-(3-hydroxy-4-methoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(C2CC(=O)Oc3ccc4c(c32)OC(=Cc2ccco2)C4=O)cc1O |
| InChI | InChI=1S/C23H16O7/c1-27-17-6-4-12(9-16(17)24)15-11-20(25)29-18-7-5-14-22(26)19(30-23(14)21(15)18)10-13-3-2-8-28-13/h2-10,15,24H,11H2,1H3 |
| InChIKey | XISVKSLWTDFDQU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|