C24H18O8 — CID 110208089
(2Z)-2-(furan-2-ylmethylidene)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 110208089) has the molecular formula C24H18O8 and a molecular weight of 434.40 g/mol. Its IUPAC name is (2Z)-2-(furan-2-ylmethylidene)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-2-(furan-2-ylmethylidene)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 110208089 |
| Molecular Formula | C24H18O8 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (2Z)-2-(furan-2-ylmethylidene)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cc(C2CC(=O)Oc3ccc4c(c32)O/C(=C\c2ccco2)C4=O)cc(OC)c1O |
| InChI | InChI=1S/C24H18O8/c1-28-17-8-12(9-18(29-2)23(17)27)15-11-20(25)31-16-6-5-14-22(26)19(32-24(14)21(15)16)10-13-4-3-7-30-13/h3-10,15,27H,11H2,1-2H3/b19-10- |
| InChIKey | YHALNOBSVNJECD-GRSHGNNSSA-N |
| XLogP | 4.06 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|