C27H22O9 — CID 110206306
(2Z)-9-(4-hydroxy-3,5-dimethoxyphenyl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 110206306) has the molecular formula C27H22O9 and a molecular weight of 490.46 g/mol. Its IUPAC name is (2Z)-9-(4-hydroxy-3,5-dimethoxyphenyl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-9-(4-hydroxy-3,5-dimethoxyphenyl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 110206306 |
| Molecular Formula | C27H22O9 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (2Z)-9-(4-hydroxy-3,5-dimethoxyphenyl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3C(c3cc(OC)c(O)c(OC)c3)CC(=O)O4)C2=O)cc1O |
| InChI | InChI=1S/C27H22O9/c1-32-18-6-4-13(8-17(18)28)9-22-25(30)15-5-7-19-24(27(15)36-22)16(12-23(29)35-19)14-10-20(33-2)26(31)21(11-14)34-3/h4-11,16,28,31H,12H2,1-3H3/b22-9- |
| InChIKey | MSKVMFINPAAEBA-AFPJDJCSSA-N |
| XLogP | 4.18 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|