C28H20O7 — CID 124879027
(2Z,9S)-9-(2H-chromen-3-yl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124879027) has the molecular formula C28H20O7 and a molecular weight of 468.46 g/mol. Its IUPAC name is (2Z,9S)-9-(2H-chromen-3-yl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-9-(2H-chromen-3-yl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124879027 |
| Molecular Formula | C28H20O7 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (2Z,9S)-9-(2H-chromen-3-yl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3[C@H](C3=Cc5ccccc5OC3)CC(=O)O4)C2=O)cc1O |
| InChI | InChI=1S/C28H20O7/c1-32-22-8-6-15(10-20(22)29)11-24-27(31)18-7-9-23-26(28(18)35-24)19(13-25(30)34-23)17-12-16-4-2-3-5-21(16)33-14-17/h2-12,19,29H,13-14H2,1H3/b24-11-/t19-/m0/s1 |
| InChIKey | OZMQHSMOZLYKCR-MRKHCSQQSA-N |
| XLogP | 4.89 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|