C28H22N2O7 — CID 124878935
(2Z,9R)-9-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124878935) has the molecular formula C28H22N2O7 and a molecular weight of 498.49 g/mol. Its IUPAC name is (2Z,9R)-9-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124878935 |
| Molecular Formula | C28H22N2O7 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (2Z,9R)-9-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3[C@@H](c3ccc5c(c3)n(C)c(=O)n5C)CC(=O)O4)C2=O)cc1O |
| InChI | InChI=1S/C28H22N2O7/c1-29-18-7-5-15(12-19(18)30(2)28(29)34)17-13-24(32)36-22-9-6-16-26(33)23(37-27(16)25(17)22)11-14-4-8-21(35-3)20(31)10-14/h4-12,17,31H,13H2,1-3H3/b23-11-/t17-/m1/s1 |
| InChIKey | OJJYSESZFZALAR-OYPWENPISA-N |
| XLogP | 3.65 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|